
Catalog Number	AR00FEGC
Chemical Name	Unii-na83F1sjsr
CAS Number	706782-28-7
Molecular Formula	C54H74F2N6O10
Molecular Weight	1005.1963664000009
MDL Number	MFCD09970919
SMILES	O[C@H]([C@H](C(=O)O)O)C(=O)O.CC(COc1ccc(cc1)CNC(=O)N(C1CCN(CC1)C)Cc1ccc(cc1)F)C.CC(COc1ccc(cc1)CNC(=O)N(C1CCN(CC1)C)Cc1ccc(cc1)F)C

N-(4-Fluorophenylmethyl)-N-(1-methylpiperidin-4-yl)-N'-(4-(2-methylpropyloxy)phenylmethyl) carbamide (2R,3R)-dihydroxybutanedioate (2:1) can be effectively utilized in chemical synthesis as a versatile building block for the creation of novel compounds. The unique structural features of this compound make it a valuable tool in the formation of complex molecules with specific functionalities. Its incorporation in chemical reactions can lead to the generation of diverse products with enhanced properties and potential applications in various fields of chemistry. With precise control over its reactivity and compatibility with different reagents, this compound offers exciting opportunities for designing and synthesizing innovative structures in the realm of organic chemistry.