
Catalog Number	AR00FC99
Chemical Name	5-(2-FLUOROPHENYL)NICOTINIC ACID
CAS Number	705961-96-2
Molecular Formula	C12H8FNO2
Molecular Weight	217.1958
MDL Number	MFCD06410258
SMILES	Fc1ccccc1c1cncc(c1)C(=O)O

5-(2-Fluorophenyl)nicotinic acid is a versatile building block in chemical synthesis. Due to its unique structure and reactivity, this compound is commonly used as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and functional materials. Its fluoro-substituted phenyl group imparts specific properties that are valuable in the creation of new compounds with enhanced biological or physical activities. In organic synthesis, 5-(2-Fluorophenyl)nicotinic acid serves as a crucial starting material for the preparation of various heterocyclic compounds, allowing chemists to design and develop novel molecules for different applications. Additionally, its compatibility with a wide range of functional groups makes it a valuable tool in the construction of complex organic frameworks through diverse synthetic strategies, including cross-coupling reactions, heterocyclization, and functional group transformations. This compound plays a significant role in the field of medicinal chemistry, where its incorporation into drug candidates can lead to improved pharmacological properties or target selectivity, making it a valuable asset for the development of new medicines with enhanced efficacy and safety profiles.