
Catalog Number	AR00ICR9
Chemical Name	6-Bromo-5-Cyano-Nicotinic Acid Ethyl Ester
CAS Number	70416-50-1
Molecular Formula	C9H7BrN2O2
Molecular Weight	255.0681
MDL Number	MFCD20925447
SMILES	CCOC(=O)c1cnc(c(c1)C#N)Br

6-Bromo-5-Cyano-Nicotinic Acid Ethyl Ester, a versatile compound used widely in chemical synthesis, offers a plethora of applications in the field of organic chemistry. As a key building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, this compound plays a crucial role in the development of novel molecules with diverse functionalities. Its ability to undergo various chemical reactions, including esterification, amidation, and cyclization, makes it an indispensable tool for the creation of complex molecular structures. In addition, the presence of the bromo and cyano functional groups enhances the reactivity and versatility of this compound, allowing for the facile introduction of further modifications. Overall, the 6-Bromo-5-Cyano-Nicotinic Acid Ethyl Ester serves as a valuable asset in the realm of chemical synthesis, enabling the synthesis of valuable compounds with potential applications across various industries.