
Catalog Number	AR00FDSK
Chemical Name	4-isopropoxy-3-(trifluoromethyl)aniline
CAS Number	70338-45-3
Molecular Formula	C10H12F3NO
Molecular Weight	219.2036
MDL Number	MFCD11053900
SMILES	CC(Oc1ccc(cc1C(F)(F)F)N)C

4-Isopropoxy-3-(trifluoromethyl)aniline, commonly known as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable building block in the creation of various organic compounds.In chemical synthesis, $name$ is frequently employed as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its trifluoromethyl group serves as a powerful electron-withdrawing moiety, enhancing the reactivity of the molecule in a variety of reactions. Additionally, the isopropoxy group provides steric bulk, influencing the selectivity and efficiency of the synthesis processes.$name$ can be utilized in the synthesis of complex molecules through processes such as nucleophilic aromatic substitution, transition metal-catalyzed coupling reactions, and halogenation reactions. Its presence in the structure imparts unique properties to the final products, making it a valuable component in the design and development of novel compounds with diverse applications.Overall, the application of 4-Isopropoxy-3-(trifluoromethyl)aniline in chemical synthesis showcases its importance as a versatile and indispensable building block for creating a wide range of valuable compounds in various industries.