
Catalog Number	AR005LEW
Chemical Name	4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid
CAS Number	701917-03-5
Molecular Formula	C10H7N3O4
Molecular Weight	233.1803
MDL Number	MFCD20484387
SMILES	[O-][N+](=O)c1cn(nc1C(=O)O)c1ccccc1

4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid is a versatile compound widely utilized in chemical synthesis due to its unique structural properties and reactivity. This compound serves as a key building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its nitro group can undergo reduction reactions to yield corresponding amino derivatives, which are essential intermediates in the synthesis of diverse compounds. Additionally, the carboxylic acid functionality enables the compound to participate in esterification or amidation reactions, further expanding its synthetic applications. With its strategic placement of functional groups, 4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid plays a crucial role in the development of complex molecules and holds significant potential in the field of organic chemistry.