
Catalog Number	AR00ICOO
Chemical Name	L-Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-(1,1-dimethylethyl)1-(4-nitrophenyl) ester
CAS Number	69876-58-0
Molecular Formula	C20H28N2O8
Molecular Weight	424.4449199999998
MDL Number	MFCD00038516
SMILES	O=C([C@@H](NC(=O)OC(C)(C)C)CCC(=O)OC(C)(C)C)Oc1ccc(cc1)[N+](=O)[O-]

Boc-Glu(OtBu)-ONp is a commonly used reagent in chemical synthesis, specifically in peptide synthesis. It serves as a protecting group for glutamic acid residues, allowing for selective deprotection and manipulation of the peptide sequence during synthesis. By incorporating Boc-Glu(OtBu)-ONp into the peptide chain, chemists can control the order in which amino acids are linked together, leading to the desired structure and properties in the final peptide product. This reagent enables efficient and precise assembly of complex peptides, making it essential in the field of pharmaceutical and biotechnological research.