
Catalog Number	AR003FXY
Chemical Name	2,2,7-Trimethyloctane-3,5-dione
CAS Number	69725-37-7
Molecular Formula	C11H20O2
Molecular Weight	184.2753
MDL Number	MFCD00511279
SMILES	CC(CC(=O)C=C(C(C)(C)C)O)C

2,2,7-Trimethyl-3,5-octanedione, commonly known as acetylacetone, is a versatile compound widely used in chemical synthesis. Its unique structure and reactivity make it a valuable reagent in various organic transformations. One of the key applications of 2,2,7-Trimethyl-3,5-octanedione is as a complexing agent in coordination chemistry. Due to its ability to chelate with metal ions, it is often employed in the synthesis of metal complexes and catalysts. Additionally, acetylacetone is utilized in the preparation of β-diketones and β-ketoesters, which are important building blocks in organic synthesis. Its role as a ligand in organometallic chemistry also enhances its utility in coordinating various transition metals. Furthermore, acetylacetone is known for its use as a precursor in the synthesis of diverse compounds such as pharmaceutical intermediates, dyes, and fragrances. Its efficient chemical properties and versatile applications establish 2,2,7-Trimethyl-3,5-octanedione as a valuable tool in modern chemical synthesis.