
Catalog Number	AR00FAWA
Chemical Name	1-CHLORO-2,4-DIMETHYL-5-NITRO-BENZENE
CAS Number	69383-68-2
Molecular Formula	C8H8ClNO2
Molecular Weight	185.6076
MDL Number	MFCD00547853
SMILES	[O-][N+](=O)c1cc(Cl)c(cc1C)C

1-Chloro-2,4-dimethyl-5-nitrobenzene is a versatile chemical compound often used in chemical synthesis for its ability to undergo various reactions and produce valuable intermediates. This compound is frequently employed as a building block in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure allows for selective functionalization at different positions, enabling the creation of complex and diverse molecules. Additionally, 1-Chloro-2,4-dimethyl-5-nitrobenzene serves as a key reagent in the preparation of various nitro-substituted aromatic compounds, providing access to a wide range of products with distinct properties and applications in industry.