
Catalog Number	AR00FB55
Chemical Name	2-Pyrimidinamine,4-(2-amino-4-methyl-5-thiazolyl)-N-[4-(4-morpholinyl)phenyl]-
CAS Number	693228-63-6
Molecular Formula	C18H20N6OS
Molecular Weight	368.456
MDL Number	MFCD14155805
SMILES	Nc1nc(c(s1)c1ccnc(n1)Nc1ccc(cc1)N1CCOCC1)C

CYC116, also known as Seliciclib, is a potent and selective inhibitor of cyclin-dependent kinases (CDKs), which are enzymes involved in regulating the cell cycle and cell proliferation. In chemical synthesis, CYC116 is utilized as a tool compound to study the effects of inhibiting specific CDKs on various cellular processes. By targeting CDKs, CYC116 can disrupt cell cycle progression and induce cell death in cancer cells, making it a valuable compound for investigating the mechanisms of cancer development and potential therapeutic interventions. Additionally, CYC116 can be used in combination with other chemical agents to explore synergistic effects in inhibiting tumor growth and overcoming drug resistance mechanisms. Its versatile applications in chemical synthesis make CYC116 a valuable asset in the field of cancer research and drug development.