
Catalog Number	AR01E5RH
Chemical Name	ArachidonicAcid-d8(Major,10mg/mlinMethylAcetate)
CAS Number	69254-37-1
Molecular Formula	C20H24D8O2
Molecular Weight	312.5162
MDL Number	MFCD00065888
SMILES	CCCCC/C(=C(C/C(=C(C/C(=C(C/C(=C(CCCC(=O)O)/[2H])/[2H])/[2H])/[2H])/[2H])/[2H])/[2H])/[2H]

Arachidonic Acid-d8 is a deuterated form of arachidonic acid, a polyunsaturated omega-6 fatty acid that plays a critical role in various biochemical pathways in the body. The addition of deuterium to arachidonic acid allows for precise tracking and identification of the molecule in chemical reactions and biological systems. In chemical synthesis, Arachidonic Acid-d8 serves as a valuable tool for isotopic labeling studies, where the deuterium atoms can be used as a tracer to follow the fate of the molecule in metabolic pathways or to determine reaction mechanisms. This isotopically labeled compound is particularly useful in studies involving lipid metabolism, inflammation, and prostaglandin synthesis. Its application in research extends to fields such as biochemistry, pharmacology, and medicinal chemistry, providing valuable insights into the role of arachidonic acid in health and disease.