
Catalog Number	AR00FF9O
Chemical Name	(+)-Piresil-4-O-beta-D-glucopyraside
CAS Number	69251-96-3
Molecular Formula	C26H32O11
Molecular Weight	520.5257
MDL Number	MFCD17214935
SMILES	OCC1OC(Oc2ccc(cc2OC)C2OCC3C2COC3c2ccc(c(c2)OC)O)C(C(C1O)O)O

The (+)-Piresil-4-O-β-D-glucopyraside is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This compound serves as a key building block in organic chemistry, particularly in the synthesis of complex natural products and pharmaceuticals. Its structural features make it a valuable intermediate for creating diverse chemical structures with specific functionalities.In chemical synthesis, (+)-Piresil-4-O-β-D-glucopyraside is commonly employed as a chiral source due to its stereochemical configuration, which can influence the stereochemistry of the final product. This compound can act as a chiral auxiliary, providing a controlled environment for asymmetric transformations and enabling the selective formation of enantiomerically pure compounds.Furthermore, the glycosidic nature of (+)-Piresil-4-O-β-D-glucopyraside allows for strategic functional group transformations, enabling chemists to introduce new chemical moieties or modify existing ones with precision. Its reactivity with various reagents and catalysts offers a broad scope for synthetic manipulations, facilitating the construction of complex molecules with high efficiency and selectivity.Overall, the application of (+)-Piresil-4-O-β-D-glucopyraside in chemical synthesis showcases its significance in advancing synthetic methodologies and expanding the repertoire of available tools for designing and accessing novel chemical compounds with diverse applications.