
Catalog Number	AR00FC9J
Chemical Name	5-Bromo-6-methyl-3-nitropyridin-2-amine
CAS Number	68957-50-6
Molecular Formula	C6H6BrN3O2
Molecular Weight	232.0347
MDL Number	MFCD00091828
SMILES	[O-][N+](=O)c1cc(Br)c(nc1N)C

5-Bromo-6-methyl-3-nitropyridin-2-amine, also known as $name$, serves as a versatile and valuable building block in chemical synthesis. This compound plays a crucial role in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique structure and reactivity.One of the key applications of $name$ in chemical synthesis is its use as a precursor in the synthesis of heterocyclic compounds. By utilizing the amino and nitro functional groups present in $name$, chemists can easily introduce diverse substituents and modifications to the pyridine ring, enabling the synthesis of structurally complex molecules with tailored properties.Moreover, the bromo and methyl groups in $name$ provide opportunities for further derivatization, allowing for the generation of novel molecules with enhanced biological or physicochemical characteristics. This versatility makes $name$ a valuable tool in the development of new drug candidates, pesticides, and functional materials.Overall, the strategic placement of functional groups in 5-Bromo-6-methyl-3-nitropyridin-2-amine offers chemists a powerful platform for designing and synthesizing a wide range of compounds with potential applications in various industries. By leveraging the unique properties of $name$, researchers can advance the field of chemical synthesis and drive innovation in the development of novel products.