
Catalog Number	AR00FFED
Chemical Name	ebericol
CAS Number	6890-88-6
Molecular Formula	C31H52O
Molecular Weight	440.744
MDL Number	MFCD17214905
SMILES	CC(C(=C)CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)C

Eburicol is a key intermediate compound in the biosynthetic pathway of ergosterol, a crucial component of fungal cell membranes. In chemical synthesis, Eburicol serves as a valuable building block for the production of novel antifungal agents and pharmaceutical compounds. Its unique structure and reactivity make it a versatile starting material for the synthesis of steroidal derivatives with potent biological activities. Researchers and chemists utilize Eburicol as a strategic precursor in the development of innovative drugs targeting fungal infections and related ailments. Its role in chemical synthesis highlights its significance in modern medicinal chemistry and pharmaceutical research.