
Catalog Number	AR01DXAH
Chemical Name	2-(3-(TRIFLUOROMETHYL)PHENYL)PROPANOIC ACID
CAS Number	68718-08-1
Molecular Formula	C10H9F3O2
Molecular Weight	218.1725
MDL Number	MFCD11036891
SMILES	OC(=O)C(c1cccc(c1)C(F)(F)F)C

2-(3-(Trifluoromethyl)phenyl)propanoic acid is a versatile compound widely utilized in chemical synthesis as a building block for the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its structural properties make it ideal for incorporation into complex molecular structures, allowing for the development of new compounds with specific desired properties.In chemical synthesis, 2-(3-(Trifluoromethyl)phenyl)propanoic acid serves as a key intermediate in the production of a range of biologically active molecules. By strategically modifying its chemical structure through reactions such as esterification, amidation, or halogenation, chemists can access a diverse array of derivatives with varying pharmacological activities.Additionally, the trifluoromethyl group present in this compound imparts unique physicochemical properties, such as increased lipophilicity and metabolic stability, which can enhance the bioavailability and bioactivity of the final products. This feature makes 2-(3-(Trifluoromethyl)phenyl)propanoic acid particularly valuable in drug discovery and development efforts aimed at improving the efficacy and safety profiles of therapeutic agents.