
Catalog Number	AR00FIBD
Chemical Name	IWP 4
CAS Number	686772-17-8
Molecular Formula	C23H20N4O3S3
Molecular Weight	496.6249
MDL Number	MFCD04457754
SMILES	COc1ccccc1n1c(SCC(=O)Nc2nc3c(s2)cc(cc3)C)nc2c(c1=O)SCC2

The compound IWP-4 is a valuable tool in chemical synthesis, particularly in the field of regenerative medicine and drug discovery. With its ability to selectively inhibit certain pathways involved in Wnt signaling, IWP-4 plays a crucial role in controlling the differentiation and proliferation of stem cells. This enables researchers to precisely manipulate cell behavior, leading to the development of specialized cell types for tissue engineering and regenerative therapies. In drug discovery, IWP-4's mechanism of action can be leveraged to investigate potential targets for treating various diseases, such as cancer and degenerative disorders. Its versatility and specificity make IWP-4 a versatile compound with significant implications for advancing scientific research and therapeutic development.