
Catalog Number	AR00FCPQ
Chemical Name	Otenabant
CAS Number	686344-29-6
Molecular Formula	C25H25Cl2N7O
Molecular Weight	510.4183
MDL Number	MFCD11973672
SMILES	CCNC1(CCN(CC1)c1ncnc2c1nc(n2c1ccc(cc1)Cl)c1ccccc1Cl)C(=O)N

The compound 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide, known for its complex molecular structure, is commonly utilized in chemical synthesis processes. This potent compound serves as a crucial building block in the development of various pharmaceuticals and organic compounds. Its unique structure and functional groups make it a valuable intermediate in the synthesis of diverse molecules, contributing to advancements in medicinal chemistry and drug discovery. With its versatile applications in chemical synthesis, this compound plays a pivotal role in the creation of innovative compounds with potential therapeutic benefits.