
Catalog Number	AR00FCHC
Chemical Name	4-phenyl-1H-imidazole-2-thiol
CAS Number	6857-34-7
Molecular Formula	C9H8N2S
Molecular Weight	176.2382
MDL Number	MFCD00460555
SMILES	S=c1[nH]cc([nH]1)c1ccccc1
NSC Number	45834

4-Phenyl-1H-imidazole-2-thiol, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis for its unique properties and diverse applications. In organic synthesis, $name$ serves as a crucial building block for the preparation of various complex molecules due to its structural flexibility and reactivity. Its sulfur-containing thiol group enables it to participate in important reactions such as nucleophilic substitution, thiol-disulfide exchange, and metal coordination, making it valuable in the development of new compounds with tailored properties. Additionally, $name$ finds extensive use in pharmaceutical research, where it is employed in the synthesis of potential drug candidates and bioactive molecules. Its ability to modulate biological activity and interact with specific targets makes it a valuable tool in the discovery and development of novel therapeutic agents. Furthermore, in material science, $name$ is instrumental in the preparation of functional materials with desired electronic, optical, or catalytic properties. Its facile synthesis and versatile reactivity make it a highly sought-after compound in the field of chemical synthesis, with applications spanning a wide range of industries and research areas.