
Catalog Number	AR00FF51
Chemical Name	1H-Indol-5-amine, 2-phenyl-
CAS Number	6855-64-7
Molecular Formula	C14H12N2
Molecular Weight	208.25848
MDL Number	MFCD17012057
SMILES	Nc1ccc2c(c1)cc([nH]2)c1ccccc1

1H-Indol-5-amine, 2-phenyl- is a key building block in organic synthesis with various applications in the field of medicinal chemistry, material science, and agrochemicals. This compound acts as a versatile intermediate for the preparation of diverse heterocyclic compounds, pharmaceuticals, and other valuable organic molecules. By harnessing its unique chemical properties, researchers and chemists are able to access a wide range of structurally complex compounds through strategic manipulations and functional group interconversions. Its significance lies in its ability to serve as a starting material for the synthesis of biologically active molecules, pharmaceuticals, and innovative materials, making it an indispensable component in the toolkit of synthetic chemists.