
Catalog Number	AR00FAVP
Chemical Name	NIST68435-07-4
CAS Number	68435-07-4
Molecular Formula	C12H18O3
Molecular Weight	210.2695
MDL Number	MFCD01838249
SMILES	COC(=O)[C@]12C[C@@H]3C[C@H](C1)C[C@](C2)(C3)O

Methyl 3-hydroxyadamantane-1-carboxylate is a versatile compound widely used in chemical synthesis as a key building block for formulating various pharmaceuticals, agrochemicals, and materials. Its unique molecular structure offers opportunities for the development of novel organic molecules with enhanced biological activities and physical properties. In organic synthesis, this compound serves as a crucial intermediate in the preparation of complex molecules, owing to its ability to undergo various reactions such as esterification, reduction, and functional group transformations. By utilizing Methyl 3-hydroxyadamantane-1-carboxylate as a starting material, chemists can efficiently access diverse chemical structures that are valuable for drug discovery and materials science. Its role in chemical synthesis highlights its significance in advancing the field of organic chemistry and facilitating the creation of innovative compounds with potential applications in pharmaceutical and agricultural industries.