
Catalog Number	AR0037AU
Chemical Name	(2,6-Bis(Trifluoromethyl)Phenyl)Boronic Acid
CAS Number	681812-07-7
Molecular Formula	C8H5BF6O2
Molecular Weight	257.9255
MDL Number	MFCD04039321
SMILES	OB(c1c(cccc1C(F)(F)F)C(F)(F)F)O

(2,6-Bis(trifluoromethyl)phenyl)boronic acid is a versatile compound commonly used in chemical synthesis for various applications. Its fluorine-containing functional groups make it an attractive building block for designing and creating unique molecules in organic chemistry. It serves as a powerful reagent in Suzuki-Miyaura cross-coupling reactions, a widely used method for forming carbon-carbon bonds. The presence of boronic acid functionality allows for the selective formation of arylboronates, which can further undergo diverse transformations to access complex molecular structures. Additionally, this compound finds utility in the development of pharmaceuticals, agrochemicals, and materials science due to its ability to participate in crucial bond-forming reactions with a high degree of reliability and efficiency.