
Catalog Number	AR00FB4D
Chemical Name	LINOLEOYLETHANOLAMIDE
CAS Number	68171-52-8
Molecular Formula	C20H37NO2
Molecular Weight	323.5133
MDL Number	MFCD00674434
SMILES	CCCCCC=CCC=CCCCCCCCC(=O)NCCO

The (9Z,12Z)-N-(2-Hydroxyethyl)octadeca-9,12-dienamide plays a vital role in chemical synthesis as a versatile compound with various applications in the field. This specific compound is commonly used as a building block in organic synthesis due to its reactive functional groups, providing opportunities for the creation of more complex molecules. Additionally, its unique structure and properties make it a valuable intermediate in the production of lipid-based materials and pharmaceuticals. In chemical reactions, (9Z,12Z)-N-(2-Hydroxyethyl)octadeca-9,12-dienamide can serve as a foundation for forming bonds with other molecules, leading to the development of novel compounds with tailored properties and functions. Its presence in chemical synthesis processes broadens the possibilities for creating innovative products with diverse applications across various industries.