
Catalog Number	AR003B4Y
Chemical Name	Carbonic acid, compd. with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:2)
CAS Number	68123-29-5
Molecular Formula	C9H24N2O9
Molecular Weight	304.2949
MDL Number	MFCD00038952
SMILES	OC(=O)O.OCC(CO)(CO)N.OCC(CO)(CO)N

The carbonic acid compound with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:2) serves as a vital reagent in chemical synthesis processes. The strategic utilization of this compound facilitates the formation of intricate organic molecules through efficient and controlled reactions. In the realm of chemical synthesis, this particular compound plays a crucial role in mediating reactions that result in the creation of diverse compounds with specific structures and properties. Its application in this context enables chemists to design and construct complex molecular frameworks with high precision and selectivity. Through its involvement in chemical synthesis, the carbonic acid compound with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:2) contributes significantly to the advancement of synthetic chemistry and the development of new materials for various scientific and industrial applications.