
Catalog Number	AR00FGIU
Chemical Name	Methyl 6-bromo-1-methylindole-2-carboxylate
CAS Number	680569-18-0
Molecular Formula	C11H10BrNO2
Molecular Weight	268.1066
MDL Number	MFCD07364734
SMILES	COC(=O)c1cc2c(n1C)cc(cc2)Br

Methyl 6-bromo-1-methylindole-2-carboxylate is a valuable compound used in various chemical synthesis procedures. Due to its versatile chemical reactivity and functional groups, this compound plays a crucial role in the synthesis of complex organic molecules and pharmaceutical intermediates. One of its key applications is as a building block in the synthesis of novel heterocyclic compounds, which are important in the development of new drugs and agrochemicals. Additionally, Methyl 6-bromo-1-methylindole-2-carboxylate can be used as a key intermediate in the production of specialty chemicals and materials, showcasing its significance in the field of organic chemistry and chemical synthesis.