
Catalog Number	AR00FC1R
Chemical Name	1,3,5-TRI-O-BENZOYL-2-O-METHYL-D-RIBOSE
CAS Number	68045-07-8
Molecular Formula	C27H24O8
Molecular Weight	476.4747
MDL Number	MFCD01630921
SMILES	CO[C@H]1C(O[C@@H]([C@H]1OC(=O)c1ccccc1)COC(=O)c1ccccc1)OC(=O)c1ccccc1

1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribofuranose is a valuable compound widely used in chemical synthesis processes. It serves as a key building block in the synthesis of various complex organic molecules, particularly in the field of carbohydrate chemistry. This compound is known for its versatility and reliability in forming important glycosidic linkages, which are essential for the creation of many biologically active compounds.In chemical synthesis, 1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribofuranose acts as a protecting group for the sugar moiety, providing stability and control during the reaction steps. By selectively deprotecting specific hydroxyl groups at strategic stages, chemists can guide the formation of specific bonds and functional groups with precision. This compound enables the synthesis of structurally intricate molecules by facilitating the manipulation of stereochemistry and regioselectivity in a controlled manner.Furthermore, 1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribofuranose offers excellent solubility in common organic solvents, making it convenient for use in various synthetic protocols. Its well-established reactivity patterns and compatibility with a range of reaction conditions make it a preferred choice for chemists working on the synthesis of natural products, pharmaceuticals, and other bioactive compounds.