
Catalog Number	AR006HP9
Chemical Name	9H-Pyrido[2,3-b]indol-2-amine,3-methyl-
CAS Number	68006-83-7
Molecular Formula	C12H11N3
Molecular Weight	197.2358
SMILES	Cc1cc2c(nc1N)[nH]c1c2cccc1

2-Amino-3-methyl-9H-pyrido[2,3-b]indole is a versatile compound widely used in chemical synthesis. Its unique molecular structure makes it a valuable building block in the creation of complex organic molecules. This compound is particularly valuable in the synthesis of pharmaceuticals and agrochemicals due to its diverse reactivity and ability to introduce key functional groups into target molecules. In addition, 2-Amino-3-methyl-9H-pyrido[2,3-b]indole is also utilized in material science for the development of novel materials with specific properties. Its incorporation into various chemical reactions enables the formation of desired products with enhanced properties, making it an essential tool for chemists in various fields of research and development.