
Catalog Number	AR005QBV
Chemical Name	2-Methoxy-5-nitroaniline hydrochloride
CAS Number	67827-72-9
Molecular Formula	C7H9ClN2O3
Molecular Weight	204.611
MDL Number	MFCD04110822
SMILES	COc1ccc(cc1N)[N+](=O)[O-].Cl

2-Methoxy-5-nitroaniline hydrochloride, also known as $name$, is a versatile compound that finds application in various chemical synthesis processes. This compound serves as a crucial starting material in the manufacturing of dyes, pigments, and pharmaceuticals due to its unique chemical properties. In chemical synthesis, $name$ acts as a key intermediate in the production of various organic compounds. It is commonly used in the development of specialized chemical reactions, such as in the synthesis of complex molecules and polymers. Its presence facilitates the formation of specific functional groups and structural motifs in the final product, making it an essential component in organic synthesis strategies.Moreover, the distinct molecular structure of 2-Methoxy-5-nitroaniline hydrochloride provides opportunities for selective chemical modifications, allowing researchers to tailor its reactivity for specific synthetic pathways. This compound's contribution to the advancement of chemical synthesis methodologies highlights its significance in the field of organic chemistry and material science.