
Catalog Number	AR006JLP
Chemical Name	(S)-2-(Chloromethyl)-1-methylpyrrolidinium chloride
CAS Number	67824-38-8
Molecular Formula	C6H13Cl2N
Molecular Weight	170.0801
MDL Number	MFCD28015782
SMILES	ClC[C@@H]1CCC[NH+]1C.[Cl-]

The Pyrrolidine, 2-(chloromethyl)-1-methyl-, hydrochloride (1:1), (2S)- is a valuable reagent in chemical synthesis due to its unique molecular structure and reactivity. As a chiral compound, it can be utilized as a catalyst or reactant in asymmetric synthesis reactions, enabling the creation of enantiomerically pure compounds. Its hydrochloride salt form enhances its solubility in various polar organic solvents, making it versatile for use in a wide range of synthetic transformations. This compound plays a crucial role in the preparation of pharmaceutical intermediates, agrochemicals, and fine chemicals with high stereochemical control, contributing to the advancement of organic chemistry research and development.