
Catalog Number	AR00FC6X
Chemical Name	13(S)-HYDROPEROXY-(9Z,11E,15Z)-OCTADECATRIENOIC ACID
CAS Number	67597-26-6
Molecular Formula	C18H30O4
Molecular Weight	310.4284
MDL Number	MFCD00216122
SMILES	CC/C=CC[C@@H](/C=C/C=CCCCCCCCC(=O)O)OO

9,11,15-octadecatrienoic acid, 13-hydroperoxy-, (9Z,11E,13S,15Z)-, also known as 13-hydroperoxy linolenic acid, plays a crucial role in chemical synthesis as a key intermediate in the biosynthesis of plant hormones called jasmonates. These compounds are involved in various physiological processes in plants, including responses to stress, growth regulation, and defense mechanisms. In chemical synthesis, 13-hydroperoxy linolenic acid serves as a precursor for the synthesis of bioactive compounds with diverse functions. It undergoes enzymatic and non-enzymatic transformations to generate a wide range of jasmonate derivatives, which have been studied for their potential applications in agriculture, pharmaceuticals, and materials science. Researchers utilize the unique reactivity of this compound to introduce functional groups and create novel molecules with specific biological activities.By harnessing the chemical properties of 13-hydroperoxy linolenic acid in synthesis, chemists can develop innovative strategies for the creation of biologically active compounds, with potential implications for drug discovery, crop protection, and materials development.