
Catalog Number	AR003C4V
Chemical Name	(1R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid
CAS Number	67111-66-4
Molecular Formula	C10H14O4
Molecular Weight	198.2158
MDL Number	MFCD00005535
SMILES	OC(=O)[C@]12CCC(C2(C)C)(C(=O)O1)C

(1R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid, often referred to as $name$, plays a crucial role in chemical synthesis due to its unique structure and reactivity. This compound is commonly utilized as a chiral building block in organic reactions to introduce stereochemistry into target molecules. Its bicyclic structure contains a carbonyl group and a carboxylic acid functionality, providing versatile synthetic pathways for the creation of complex organic compounds.In chemical synthesis, $name$ can act as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. Its presence in a molecule can influence the overall stereochemistry of the final product, making it a valuable tool for controlling chirality in synthetic pathways. Furthermore, the carbonyl and carboxylic acid groups present in $name$ enable it to participate in a range of reactions such as acylation, esterification, and condensation, expanding its utility in diverse synthetic schemes.Overall, the application of (1R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid in chemical synthesis highlights its significance as a versatile chiral synthon that contributes to the construction of complex organic molecules with well-defined stereochemistry.