
Catalog Number	AR006MK7
Chemical Name	Dimethylbis(pentamethylcyclopentadienyl)zirconium(IV)
CAS Number	67108-80-9
Molecular Formula	C22H34Zr
Molecular Weight	389.7294
MDL Number	MFCD01863658
SMILES	C[C-]12[C]3(=[C]4([Zr+4]5678923([C]1(=[C]45C)C)([CH2-])([CH2-])[C]1(=[C]8([C]7(=[C]6([C-]91C)C)C)C)C)C)C

Dimethylbis(pentamethylcyclopentadienyl)zirconium(IV) is a versatile organometallic compound commonly used in chemical synthesis. Its unique structure and reactivity make it a valuable reagent in various synthetic applications. This compound is often employed as a catalyst in organic transformations such as olefin polymerization, cyclopropanation, and carbon-carbon bond formation reactions. Its high activity and selectivity in these processes make it a preferred choice for chemists working in the field of organic synthesis.Additionally, Dimethylbis(pentamethylcyclopentadienyl)zirconium(IV) can also act as a precursor to other zirconium complexes with different ligands, allowing for the fine-tuning of catalytic properties and expanding its utility in a broader range of chemical reactions.Overall, this compound plays a crucial role in facilitating complex molecular transformations and enabling the synthesis of valuable organic compounds with high efficiency and precision.

Pyridine, 3-bromo-2,6-bis(phenylmethoxy)-

16727-47-2

$3.00/100mg, $4.00/250mg, $4.00/1g, $8.00/5g, $13.00/10g, $21.00/25g, $61.00/100g, $122.00/250g, $225.00/500g, $433.00/1kg, $2,077.00/5kg, $3,808.00/10kg,

Product Details