
Catalog Number	AR00FBJE
Chemical Name	Dicyclomine hydrochloride
CAS Number	67-92-5
Molecular Formula	C19H36ClNO2
Molecular Weight	345.9476
MDL Number	MFCD00079158
SMILES	CCN(CCOC(=O)C1(CCCCC1)C1CCCCC1)CC.Cl
NSC Number	756727

Dicyclomine hydrochloride, also known as dicycloverine hydrochloride, is a medication commonly used in chemical synthesis for its pharmacological properties. It belongs to a class of drugs called anticholinergic agents and is primarily utilized in the synthesis of pharmaceutical compounds targeting the muscarinic acetylcholine receptors.Due to its ability to selectively block the muscarinic receptors in smooth muscle, Dicyclomine hydrochloride is employed in the production of medications aimed at reducing gastrointestinal motility and relieving symptoms associated with irritable bowel syndrome (IBS). By inhibiting the action of acetylcholine on these receptors, Dicyclomine hydrochloride helps alleviate abdominal cramping, spasms, and discomfort caused by overactive smooth muscle contractions in the intestines.In the field of chemical synthesis, Dicyclomine hydrochloride serves as a valuable building block for creating novel pharmaceutical formulations that target the cholinergic system. Its specific mechanism of action and therapeutic effects make it a useful component in the development of drugs designed to modulate cholinergic pathways, offering potential treatment options for various gastrointestinal disorders and related conditions.