
Catalog Number	AR00FBB5
Chemical Name	N-Boc-(3'-chlorophenyl)glycine
CAS Number	669713-92-2
Molecular Formula	C13H16ClNO4
Molecular Weight	285.7234
MDL Number	MFCD03426365
SMILES	O=C(OC(C)(C)C)NC(c1cccc(c1)Cl)C(=O)O

2-((tert-Butoxycarbonyl)amino)-2-(3-chlorophenyl)acetic acid, commonly referred to as $name$, is a versatile compound widely used in chemical synthesis processes. Its primary application lies in the realm of peptide synthesis, where it serves as a key building block in the creation of complex peptides.As a derivative of amino acids, $name$ plays a crucial role in protecting specific functional groups during peptide assembly. By utilizing the tert-butoxycarbonyl (Boc) protecting group, this compound shields the amine functionality, preventing unwanted side reactions and ensuring precise control over the peptide's sequence and structure.Furthermore, the presence of the 3-chlorophenyl moiety in $name$ enhances its compatibility with various coupling reagents and facilitates efficient peptide bond formation. This characteristic is especially valuable in solid-phase peptide synthesis methods, where the compound demonstrates high reactivity and stability, leading to improved yields and purities.In summary, 2-((tert-Butoxycarbonyl)amino)-2-(3-chlorophenyl)acetic acid is an indispensable tool in the chemical synthesis of peptides, offering chemists a reliable means to construct intricate peptide structures with precision and efficiency.