
Catalog Number	AR00ICCO
Chemical Name	b-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, methyl ester
CAS Number	669058-18-8
Molecular Formula	C19H19NO4
Molecular Weight	325.3585
MDL Number	MFCD18328524
SMILES	COC(=O)CCNC(=O)OCC1c2ccccc2c2c1cccc2

The compound b-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, methyl ester serves as a valuable building block in chemical synthesis processes. With its unique structure and reactivity, this compound plays a crucial role in the creation of various organic compounds. Specifically, it is utilized as a key intermediate in the synthesis of complex molecules, including pharmaceuticals, agrochemicals, and advanced materials. Its incorporation in chemical reactions enables the formation of new carbon-carbon bonds and the introduction of functional groups essential for the development of diverse compounds with specific properties and applications. Through its involvement in chemical synthesis, b-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, methyl ester contributes significantly to the advancement of scientific research and the discovery of innovative products across various industries.