
Catalog Number	AR01ANFV
Chemical Name	propan-2-yl (2S)-2-amino-3-methylbutanoate hydrochloride
CAS Number	66854-99-7
Molecular Formula	C8H18ClNO2
Molecular Weight	195.6870
MDL Number	MFCD29041064
SMILES	CC(OC(=O)[C@H](C(C)C)N)C.Cl

Propan-2-yl (2S)-2-amino-3-methylbutanoate hydrochloride is a versatile compound used in chemical synthesis for its ability to participate in various transformations and reactions. This compound serves as a valuable building block for the synthesis of organic molecules, particularly in the field of medicinal chemistry and drug development. With its unique structural features, Propan-2-yl (2S)-2-amino-3-methylbutanoate hydrochloride can be utilized as a key intermediate in the synthesis of pharmaceutical compounds and bioactive molecules. Its incorporation in chemical reactions allows for the construction of complex molecular structures, enabling the creation of diverse compounds with specific properties and functions. By serving as a strategic starting material in synthetic pathways, this compound contributes significantly to the development of novel chemical entities with potential applications in various industries.