
Catalog Number	AR00FBR5
Chemical Name	2-(2,3-Dimethyl-phenoxy)-2-methyl-propionic acid
CAS Number	667440-80-4
Molecular Formula	C12H16O3
Molecular Weight	208.2536
MDL Number	MFCD03422275
SMILES	OC(=O)C(Oc1cccc(c1C)C)(C)C

2-(2,3-Dimethylphenoxy)-2-methylpropanoic acid is a versatile compound widely used in chemical synthesis as a key building block. Its unique structure allows for the creation of various derivatives with distinct properties and functionalities. In organic synthesis, this compound is often utilized as a reagent for forming new carbon-carbon or carbon-heteroatom bonds through its reactive functional groups. Additionally, its compatibility with a range of reaction conditions makes it a valuable tool in designing complex molecular structures. Overall, the application of 2-(2,3-Dimethylphenoxy)-2-methylpropanoic acid in chemical synthesis offers researchers the opportunity to efficiently access diverse chemical motifs for the development of novel materials, pharmaceuticals, and fine chemicals.