
Catalog Number	AR00FHD9
Chemical Name	4-CHLORO-6-ETHOXY-2-METHYLQUINOLINE
CAS Number	66735-22-6
Molecular Formula	C12H12ClNO
Molecular Weight	221.6828
SMILES	CCOc1ccc2c(c1)c(Cl)cc(n2)C

4-Chloro-6-ethoxy-2-methylquinoline is a versatile compound commonly used in chemical synthesis for its unique reactivity and structural properties. This compound serves as a valuable building block in the creation of various organic molecules due to its functional groups and substituents, making it a crucial component in the development of pharmaceuticals, agrochemicals, and other specialty chemicals. In chemical synthesis, 4-Chloro-6-ethoxy-2-methylquinoline can undergo numerous reactions such as halogenation, alkylation, acylation, and cyclization, leading to the formation of complex molecular structures with specific desired properties. Its ability to participate in diverse chemical transformations makes it an indispensable tool for researchers and chemists working in the field of organic synthesis.