
Catalog Number	AR00FCFD
Chemical Name	2-(3-ISOBUTYLPHENYL)PROPANOIC ACID
CAS Number	66622-47-7
Molecular Formula	C13H18O2
Molecular Weight	206.2808
MDL Number	MFCD08275582
SMILES	CC(Cc1cccc(c1)C(C(=O)O)C)C

2-(3-Isobutylphenyl)propanoic acid, also known as ibuprofen, plays a crucial role in chemical synthesis as a versatile building block. This compound is widely utilized in the pharmaceutical industry for the synthesis of various advanced drug molecules. Its incorporation in organic reactions serves as a key step in the creation of new pharmaceutical compounds with enhanced therapeutic properties. By serving as a core component in the synthesis of more complex pharmaceuticals, 2-(3-Isobutylphenyl)propanoic acid contributes significantly to the development of novel drugs that target specific diseases and medical conditions. Its applications in chemical synthesis showcase its importance as a foundational material in pharmaceutical research and development.