
Catalog Number	AR00ICAX
Chemical Name	Piperidine, 4-[3-(trifluoromethyl)phenyl]-, hydrochloride
CAS Number	6652-16-0
Molecular Formula	C12H15ClF3N
Molecular Weight	265.7024
MDL Number	MFCD02178913
SMILES	FC(c1cccc(c1)C1CCNCC1)(F)F.Cl

4-(3-(Trifluoromethyl)phenyl)piperidine hydrochloride is a versatile chemical compound utilized in various chemical syntheses. With its unique structure incorporating a trifluoromethyl group and a piperidine ring, this compound serves as a valuable building block for the creation of diverse molecules in organic chemistry. In particular, it is commonly employed as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. The presence of the trifluoromethyl group enhances the compound's reactivity and imparts valuable properties to the resulting products. Overall, 4-(3-(Trifluoromethyl)phenyl)piperidine hydrochloride plays a crucial role in modern chemical synthesis, enabling the efficient creation of complex and valuable compounds with a wide range of applications.