
Catalog Number	AR003GPQ
Chemical Name	2,5-dioxopyrrolidin-1-yl 4-methyl-4-((5-nitropyridin-2-yl)disulfanyl)pentanoate
CAS Number	663598-98-9
Molecular Formula	C15H17N3O6S2
Molecular Weight	399.442
MDL Number	MFCD20228009
SMILES	O=C(ON1C(=O)CCC1=O)CCC(SSc1ccc(cn1)[N+](=O)[O-])(C)C

The compound 2,5-dioxopyrrolidin-1-yl 4-methyl-4-((5-nitropyridin-2-yl)disulfanyl)pentanoate serves as a valuable reagent in chemical synthesis, particularly in the realm of organic chemistry. This compound is utilized as a key building block for the construction of various complex molecules due to its unique chemical structure and reactivity.In chemical synthesis, this compound can function as a versatile intermediate in the formation of diverse organic compounds through different synthetic routes. Its reactive functional groups enable it to participate in a range of reactions, such as esterification, nucleophilic substitution, and disulfide bond formation, making it a valuable tool for chemical transformations.Furthermore, the presence of the nitro and pyridinyl moieties in the molecule can impart specific properties or reactivity to the final products, depending on the desired application. These functionalities can be crucial for introducing specific characteristics or functions into the synthesized compounds, making them useful in various fields such as pharmaceuticals, materials science, and agrochemicals.