
Catalog Number	AR00FH4H
Chemical Name	tert-butyl 6-oxo-3-aza-bicyclo[3.2.0]heptane-3-carboxylate
CAS Number	663172-80-3
Molecular Formula	C11H17NO3
Molecular Weight	211.2576
MDL Number	MFCD12911861
SMILES	O=C(N1CC2C(C1)CC2=O)OC(C)(C)C

Tert-Butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate, also known as $name$, is a versatile compound commonly employed in chemical synthesis. Its unique molecular structure and reactivity make it particularly useful in organic chemistry applications.$name$ serves as a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its presence in a chemical reaction can facilitate the formation of complex molecular structures with high efficiency and selectivity. By incorporating $name$ into the synthesis process, chemists can access novel compounds that may exhibit desired biological activities or properties.One notable application of $name$ is in the preparation of heterocyclic compounds, which are essential components in drug discovery and development. The functional groups present in $name$ can participate in key reactions such as cycloadditions, ring closures, and functional group transformations, enabling the construction of diverse chemical scaffolds.Furthermore, $name$ can act as a protecting group for sensitive functional moieties during synthetic transformations, allowing chemists to selectively modify specific regions of a molecule without affecting other reactive sites. This selective reactivity makes $name$ a valuable tool in the strategic design and synthesis of complex organic molecules.In summary, the application of tert-Butyl 6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate in chemical synthesis offers a wide range of possibilities for constructing intricate molecular architectures and advancing the field of organic chemistry with its versatility and efficacy.