
Catalog Number	AR00FB5N
Chemical Name	2-(3-CHLORO-PHENYL)-SUCCINIC ACID
CAS Number	66041-28-9
Molecular Formula	C10H9ClO4
Molecular Weight	228.6291
MDL Number	MFCD06658407
SMILES	OC(=O)CC(c1cccc(c1)Cl)C(=O)O

2-(3-Chlorophenyl)succinic acid, also known as dichlorphenesin, plays a crucial role in chemical synthesis as a versatile intermediate. This compound finds wide application in the pharmaceutical industry, particularly in the synthesis of various drugs and biologically active molecules. Its unique structure and functional groups allow for it to be easily modified and incorporated into complex molecular frameworks, enabling the synthesis of diverse classes of compounds.In chemical synthesis, 2-(3-Chlorophenyl)succinic acid serves as a key building block for the creation of pharmaceuticals such as muscle relaxants and analgesics. Its presence allows chemists to introduce specific functionalities or structural motifs into target molecules, thereby enhancing their biological activity or improving their pharmacokinetic profiles. Additionally, the synthesis of new drug candidates often relies on the strategic use of this intermediate to access novel molecular scaffolds with potential therapeutic benefits.Furthermore, the versatility of 2-(3-Chlorophenyl)succinic acid extends beyond the realm of pharmaceuticals, as it is also utilized in the synthesis of agrochemicals, specialty chemicals, and materials science. By harnessing the reactivity and selectivity of this compound, chemists can efficiently construct complex molecules with tailored properties for various industrial applications. Its presence in the chemical synthesis toolbox highlights its importance as a valuable building block for the creation of diverse compounds with significant scientific and commercial impact.