
Catalog Number	AR00FAMG
Chemical Name	ARSENAZO I TRISODIUM SALT
CAS Number	66019-20-3
Molecular Formula	C16H13AsN2NaO11S2
Molecular Weight	571.3226
MDL Number	MFCD00003937
SMILES	Oc1cc(cc2c1c(O)c(c(c2)S(=O)(=O)O)/N=N/c1ccccc1[As](=O)(O)O)S(=O)(=O)O.[Na]

Sodium 3-[2-(2-arsonophenyl)diazenyl]-4,5-dihydroxy-2,7-naphthalenedisulfonate (3:1) serves as a valuable reagent in chemical synthesis, particularly in the field of organic chemistry. This compound is utilized as a sulfonating agent, playing a crucial role in introducing sulfonic acid groups onto organic molecules. By leveraging the unique reactivity of the arsenazo group, this compound enables the selective functionalization of aromatic systems, leading to the synthesis of a diverse array of sulfonated compounds. Furthermore, the presence of multiple hydroxy groups in the naphthalene backbone enhances the solubility and stability of the reagent, facilitating its incorporation into various synthetic pathways. Leveraging the distinctive properties of Sodium 3-[2-(2-arsonophenyl)diazenyl]-4,5-dihydroxy-2,7-naphthalenedisulfonate in chemical synthesis allows for the efficient modification and diversification of organic molecules for applications in pharmaceuticals, materials science, and other industries.