
Catalog Number	AR00FI4G
Chemical Name	7-Hydroxyquinoline-3-carboxylic acid
CAS Number	659730-27-5
Molecular Formula	C10H7NO3
Molecular Weight	189.1675
MDL Number	MFCD18417142
SMILES	Oc1ccc2c(c1)ncc(c2)C(=O)O

7-Hydroxyquinoline-3-carboxylic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block in the production of pharmaceuticals and agrochemicals. This compound serves as a key intermediate in the synthesis of various heterocyclic compounds due to its unique structural properties and reactivity.$name$ is commonly utilized as a precursor in the preparation of quinoline derivatives, which are essential components in the development of antimalarial, antibacterial, and anticancer agents. Its functional groups enable diverse modification through chemical reactions such as acylation, alkylation, and condensation, allowing for the creation of novel compounds with enhanced biological activities.Moreover, $name$ serves as a crucial chelating agent in coordination chemistry, forming stable complexes with metal ions. This characteristic is exploited in the synthesis of metal-based catalysts for organic transformations and asymmetric reactions. Additionally, $name$ exhibits fluorescent properties, making it valuable in the design of probes for metal ion detection and imaging applications.Overall, the strategic incorporation of 7-Hydroxyquinoline-3-carboxylic acid in chemical synthesis enables the efficient construction of complex molecular structures with diverse functionalities, making it an indispensable tool for drug discovery and materials science.