
Catalog Number	AR00FG1X
Chemical Name	4-Methyl-5-nitrobenzene-1,2-diaMine
CAS Number	65958-37-4
Molecular Formula	C7H9N3O2
Molecular Weight	167.1653
MDL Number	MFCD21604161
SMILES	[O-][N+](=O)c1cc(N)c(cc1C)N

A vital component in chemical synthesis processes, 1,2-Benzenediamine, 4-methyl-5-nitro- serves as a versatile building block for the creation of various complex organic compounds. It is commonly employed in the pharmaceutical industry for the synthesis of new drug molecules due to its ability to react with a wide range of functional groups. Additionally, this compound finds application in the production of specialty chemicals such as dyes, pigments, and polymers. Its unique structure and reactivity make it a valuable tool for chemists seeking to design and develop novel materials with specific properties and functions.