
Catalog Number	AR00FG1E
Chemical Name	6-Benzimidazolecarboxylicacid,1,2-dimethyl-(7CI,8CI)
CAS Number	6595-00-2
Molecular Formula	C10H10N2O2
Molecular Weight	190.1986
MDL Number	MFCD13562914
SMILES	OC(=O)c1ccc2c(c1)n(C)c(n2)C

1,2-Dimethyl-1H-benzo[d]imidazole-6-carboxylic acid is a versatile compound that finds application in chemical synthesis, particularly in the pharmaceutical industry. This compound serves as a valuable building block in the synthesis of various biologically active molecules due to its unique structure and reactivity.In chemical synthesis, 1,2-Dimethyl-1H-benzo[d]imidazole-6-carboxylic acid can be employed as a key intermediate in the preparation of heterocyclic compounds, which are essential in the development of new pharmaceuticals. By incorporating this compound into synthetic routes, chemists can access a wide range of derivatives with diverse pharmacological properties.Furthermore, the functional groups present in 1,2-Dimethyl-1H-benzo[d]imidazole-6-carboxylic acid allow for facile modification, enabling chemists to introduce specific substituents and tailor the compound's properties for desired applications. This flexibility in chemical manipulation makes it a valuable tool in the synthesis of complex molecules with therapeutic potential.Overall, 1,2-Dimethyl-1H-benzo[d]imidazole-6-carboxylic acid plays a crucial role in chemical synthesis, particularly in the development of novel pharmaceuticals with enhanced biological activities. Its versatility and reactivity make it a valuable asset for chemists seeking to explore new pathways in drug discovery and medicinal chemistry.