
Catalog Number	AR00FDPK
Chemical Name	2-(4-nitrophenyl)-2-oxoethyl acetate
CAS Number	65921-30-4
Molecular Formula	C10H9NO5
Molecular Weight	223.1822
MDL Number	MFCD09152776
SMILES	CC(=O)OCC(=O)c1ccc(cc1)[N+](=O)[O-]

2-(4-Nitrophenyl)-2-oxoethyl acetate is a valuable compound widely used in chemical synthesis for its versatile applications. This compound serves as a key building block in the creation of various organic molecules due to its unique functional groups and reactivity.In chemical synthesis, 2-(4-Nitrophenyl)-2-oxoethyl acetate is commonly employed as a precursor in the preparation of pharmaceutical intermediates, agrochemicals, and fine chemicals. Its acetyl group provides a convenient handle for further derivatization, while the nitrophenyl moiety can undergo various chemical transformations to introduce specific functionalities into the target molecules.Furthermore, the reactive carbonyl group in 2-(4-Nitrophenyl)-2-oxoethyl acetate allows for efficient and selective formation of carbon-carbon and carbon-heteroatom bonds, enabling chemists to construct complex molecular architectures with high precision. This compound's versatility and synthetic utility make it an essential component in the toolbox of organic chemists working in medicinal chemistry, materials science, and other research fields.