
Catalog Number	AR00IC8A
Chemical Name	Benzamide, 3-fluoro-N-methyl-4-nitro-
CAS Number	658700-20-0
Molecular Formula	C8H7FN2O3
Molecular Weight	198.15118319999996
MDL Number	MFCD14583038
SMILES	CNC(=O)c1ccc(c(c1)F)[N+](=O)[O-]

The application of 3-Fluoro-N-methyl-4-nitrobenzamide in chemical synthesis is crucial in the development and production of various organic compounds. This compound serves as a key building block in the synthesis of pharmaceuticals, agrochemicals, and materials with diverse functionalities. Its unique structure and reactivity make it a versatile intermediate in organic reactions, allowing for the introduction of fluorine, methyl, and nitro groups into a wide range of molecular frameworks. By incorporating 3-Fluoro-N-methyl-4-nitrobenzamide into complex synthesis pathways, chemists can access new chemical entities with tailored properties and applications.