65717-97-7 | MFCD00056689 | N-[[2,6-Diisopropylphenylcarbamoyl]methyl]imino_x000D

Packsize	Purity	Price	Availability
100mg	97%	$36.00	Global Stock	Buy Now	Add To Cart
250mg	97%	$61.00	Global Stock	Buy Now	Add To Cart
1g	97%	$168.00	Global Stock	Buy Now	Add To Cart
5g	97%	$593.00	Global Stock	Buy Now	Add To Cart


Catalog Number	AR003SXB
Chemical Name	N-[[2,6-Diisopropylphenylcarbamoyl]methyl]imino_x000D_ diacetic acid
CAS Number	65717-97-7
Molecular Formula	C18H26N2O5
Molecular Weight	350.4094
MDL Number	MFCD00056689
SMILES	CC(c1cccc(c1NC(=O)CN(CC(=O)O)CC(=O)O)C(C)C)C

2,2'-((2-((2,6-Diisopropylphenyl)amino)-2-oxoethyl)azanediyl)diacetic acid, also known by its chemical formula $name$, is a versatile compound that plays a crucial role in chemical synthesis. This compound is widely used as a chelating agent, particularly in complexation reactions involving metal ions. Its unique structure allows for the formation of stable complexes with various metal ions, making it an essential component in the preparation of coordination compounds.In chemical synthesis, $name$ is employed in the synthesis of metal complexes and catalysts due to its ability to bind metal ions with high affinity and specificity. This compound facilitates the isolation and purification of metal complexes, enabling researchers to study their reactivity and properties effectively.Moreover, $name$ is utilized in the development of novel materials, such as coordination polymers and metal-organic frameworks. Its chelating properties contribute to the controlled assembly of metal nodes, leading to the formation of intricate structures with tailored functionalities.Overall, the application of 2,2'-((2-((2,6-Diisopropylphenyl)amino)-2-oxoethyl)azanediyl)diacetic acid in chemical synthesis opens up a wide range of possibilities for designing new molecules, understanding metal-ligand interactions, and advancing the field of coordination chemistry.