Name: Name:3-hydroxy-5-cholestenoic acid
Brand: Aaron Chemicals
SKU: AR00EFZ2
Rating: 96 (1 reviews)


Catalog Number	AR00EFZ2
Chemical Name	3-hydroxy-5-cholestenoic acid
CAS Number	6561-58-6
Molecular Formula	C27H44O3
Molecular Weight	416.6365
MDL Number	MFCD28143663
SMILES	O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2[C@@H](CCCC(C(=O)O)C)C)C)C1)C

3β-Hydroxy-5-cholestenoic acid is a valuable compound in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a crucial intermediate in the synthesis of various steroidal compounds, including hormone derivatives and pharmaceutical agents. Due to its unique structure and functional groups, 3β-Hydroxy-5-cholestenoic acid can be used as a key building block for the preparation of important steroids and related bioactive molecules. Its versatile reactivity allows for the formation of intricate molecular structures through various synthetic routes, making it an essential component in the development of new drugs and medical research. In addition, the distinctive properties of 3β-Hydroxy-5-cholestenoic acid make it a valuable tool in the study of lipid metabolism and cholesterol biosynthesis pathways, offering insights into important biological processes and potential therapeutic interventions.

5-Oxazolemethanol

127232-41-1

$14.00/100mg, $14.00/250mg, $29.00/1g,

Product Details

1(2H)-Isoquinolinone, 5-bromo-

190777-77-6

$7.00/100mg, $10.00/250mg, $24.00/1g, $56.00/5g, $112.00/10g, $278.00/25g,

Product Details

2-Methyl-3,5-dinitroaniline

35572-78-2

$50.00/50mg, $104.00/250mg, $277.00/1g, $1,039.00/5g,

Product Details