
Catalog Number	AR00EFIM
Chemical Name	Quinoline-6-sulfonyl chloride
CAS Number	65433-99-0
Molecular Formula	C9H6ClNO2S
Molecular Weight	227.6674
MDL Number	MFCD03086095
SMILES	ClS(=O)(=O)c1ccc2c(c1)cccn2

Quinoline-6-sulfonyl chloride is a versatile chemical reagent commonly utilized in organic synthesis. This compound serves as a key building block in the production of various pharmaceuticals, agrochemicals, and functional materials. In chemical synthesis, Quinoline-6-sulfonyl chloride is often employed as a sulfonylating agent, allowing for the introduction of the sulfonyl functional group onto target molecules. This modification can impart desired properties or functionalities to the final compounds. Furthermore, Quinoline-6-sulfonyl chloride can also act as a protecting group, temporarily shielding specific reactive sites on molecules during synthetic transformations. Its stability and reactivity make it a valuable tool in the development of complex organic molecules with precise control over regioselectivity and stereochemistry.